C22H21Cl2N3O3 — CID 55609258
5-cyclopropyl-1-(2,4-dichlorophenyl)-N-[2-(3-methoxyphenoxy)ethyl]pyrazole-4-carboxamide (PubChem CID 55609258) has the molecular formula C22H21Cl2N3O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is 5-cyclopropyl-1-(2,4-dichlorophenyl)-N-[2-(3-methoxyphenoxy)ethyl]pyrazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-1-(2,4-dichlorophenyl)-N-[2-(3-methoxyphenoxy)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55609258 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 5-cyclopropyl-1-(2,4-dichlorophenyl)-N-[2-(3-methoxyphenoxy)ethyl]pyrazole-4-carboxamide |
| SMILES | COc1cccc(OCCNC(=O)c2cnn(-c3ccc(Cl)cc3Cl)c2C2CC2)c1 |
| InChI | InChI=1S/C22H21Cl2N3O3/c1-29-16-3-2-4-17(12-16)30-10-9-25-22(28)18-13-26-27(21(18)14-5-6-14)20-8-7-15(23)11-19(20)24/h2-4,7-8,11-14H,5-6,9-10H2,1H3,(H,25,28) |
| InChIKey | PIBBBKWPVDXBAB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|