C17H20ClN3O4S — CID 22267580
ethyl 1-[2-chloro-4-(dimethylsulfamoyl)phenyl]-5-cyclopropylpyrazole-4-carboxylate (PubChem CID 22267580) has the molecular formula C17H20ClN3O4S and a molecular weight of 397.88 g/mol. Its IUPAC name is ethyl 1-[2-chloro-4-(dimethylsulfamoyl)phenyl]-5-cyclopropylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-[2-chloro-4-(dimethylsulfamoyl)phenyl]-5-cyclopropylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 22267580 |
| Molecular Formula | C17H20ClN3O4S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | ethyl 1-[2-chloro-4-(dimethylsulfamoyl)phenyl]-5-cyclopropylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(S(=O)(=O)N(C)C)cc2Cl)c1C1CC1 |
| InChI | InChI=1S/C17H20ClN3O4S/c1-4-25-17(22)13-10-19-21(16(13)11-5-6-11)15-8-7-12(9-14(15)18)26(23,24)20(2)3/h7-11H,4-6H2,1-3H3 |
| InChIKey | ILKFROJXKJIHBF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |