C19H16F3N3O2 — CID 22268014
ethyl 5-cyclopropyl-1-[6-(trifluoromethyl)quinolin-7-yl]pyrazole-4-carboxylate (PubChem CID 22268014) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is ethyl 5-cyclopropyl-1-[6-(trifluoromethyl)quinolin-7-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-cyclopropyl-1-[6-(trifluoromethyl)quinolin-7-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 22268014 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | ethyl 5-cyclopropyl-1-[6-(trifluoromethyl)quinolin-7-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cc3ncccc3cc2C(F)(F)F)c1C1CC1 |
| InChI | InChI=1S/C19H16F3N3O2/c1-2-27-18(26)13-10-24-25(17(13)11-5-6-11)16-9-15-12(4-3-7-23-15)8-14(16)19(20,21)22/h3-4,7-11H,2,5-6H2,1H3 |
| InChIKey | HONXRCNRMIFFFI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |