C16H19Cl2N3 — CID 66441275
N-[[5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazol-4-yl]methyl]propan-1-amine (PubChem CID 66441275) has the molecular formula C16H19Cl2N3 and a molecular weight of 324.26 g/mol. Its IUPAC name is N-[[5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66441275 |
| Molecular Formula | C16H19Cl2N3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[[5-cyclopropyl-1-(2,4-dichlorophenyl)pyrazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnn(-c2ccc(Cl)cc2Cl)c1C1CC1 |
| InChI | InChI=1S/C16H19Cl2N3/c1-2-7-19-9-12-10-20-21(16(12)11-3-4-11)15-6-5-13(17)8-14(15)18/h5-6,8,10-11,19H,2-4,7,9H2,1H3 |
| InChIKey | JIEQXQCHAGYZMJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|