C15H17ClN4O2 — CID 18138371
5-(4-chlorophenyl)-N'-(3-methylbutanoyl)-1H-pyrazole-4-carbohydrazide (PubChem CID 18138371) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-(3-methylbutanoyl)-1H-pyrazole-4-carbohydrazide.
| Compound Name | 5-(4-chlorophenyl)-N'-(3-methylbutanoyl)-1H-pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 18138371 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-(3-methylbutanoyl)-1H-pyrazole-4-carbohydrazide |
| SMILES | CC(C)CC(=O)NNC(=O)c1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClN4O2/c1-9(2)7-13(21)18-20-15(22)12-8-17-19-14(12)10-3-5-11(16)6-4-10/h3-6,8-9H,7H2,1-2H3,(H,17,19)(H,18,21)(H,20,22) |
| InChIKey | FJMKMZRDVQMEGF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|