C18H21N3O3 — CID 18106384
4-acetyl-N'-(2,4-dimethylbenzoyl)-3,5-dimethyl-1H-pyrrole-2-carbohydrazide (PubChem CID 18106384) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-acetyl-N'-(2,4-dimethylbenzoyl)-3,5-dimethyl-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-acetyl-N'-(2,4-dimethylbenzoyl)-3,5-dimethyl-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 18106384 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-acetyl-N'-(2,4-dimethylbenzoyl)-3,5-dimethyl-1H-pyrrole-2-carbohydrazide |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)NNC(=O)c2ccc(C)cc2C)c1C |
| InChI | InChI=1S/C18H21N3O3/c1-9-6-7-14(10(2)8-9)17(23)20-21-18(24)16-11(3)15(13(5)22)12(4)19-16/h6-8,19H,1-5H3,(H,20,23)(H,21,24) |
| InChIKey | PLEHUDYSKGAMKN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|