C18H19Cl2N3O3 — CID 38993918
4-acetyl-N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide (PubChem CID 38993918) has the molecular formula C18H19Cl2N3O3 and a molecular weight of 396.27 g/mol. Its IUPAC name is 4-acetyl-N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 38993918 |
| Molecular Formula | C18H19Cl2N3O3 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 4-acetyl-N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)NCCNC(=O)c2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C18H19Cl2N3O3/c1-9-15(11(3)24)10(2)23-16(9)18(26)22-7-6-21-17(25)12-4-5-13(19)14(20)8-12/h4-5,8,23H,6-7H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | AKEQRZNEOIAWGA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|