C17H19N5O5 — CID 55463130
N'-[2-(4-methoxyanilino)acetyl]-2-(methylamino)-5-nitrobenzohydrazide (PubChem CID 55463130) has the molecular formula C17H19N5O5 and a molecular weight of 373.37 g/mol. Its IUPAC name is N'-[2-(4-methoxyanilino)acetyl]-2-(methylamino)-5-nitrobenzohydrazide.
| Compound Name | N'-[2-(4-methoxyanilino)acetyl]-2-(methylamino)-5-nitrobenzohydrazide |
|---|---|
| PubChem CID | 55463130 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N'-[2-(4-methoxyanilino)acetyl]-2-(methylamino)-5-nitrobenzohydrazide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)NNC(=O)CNc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H19N5O5/c1-18-15-8-5-12(22(25)26)9-14(15)17(24)21-20-16(23)10-19-11-3-6-13(27-2)7-4-11/h3-9,18-19H,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | UBNVTHWOQXEOQL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|