C16H17N5O4 — CID 154759918
N'-(2-anilinoacetyl)-2-(methylamino)-5-nitrobenzohydrazide (PubChem CID 154759918) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is N'-(2-anilinoacetyl)-2-(methylamino)-5-nitrobenzohydrazide.
| Compound Name | N'-(2-anilinoacetyl)-2-(methylamino)-5-nitrobenzohydrazide |
|---|---|
| PubChem CID | 154759918 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N'-(2-anilinoacetyl)-2-(methylamino)-5-nitrobenzohydrazide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)NNC(=O)CNc1ccccc1 |
| InChI | InChI=1S/C16H17N5O4/c1-17-14-8-7-12(21(24)25)9-13(14)16(23)20-19-15(22)10-18-11-5-3-2-4-6-11/h2-9,17-18H,10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | OHYUJKQHNWIPFO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|