C15H13BrN4O4 — CID 9081549
2-bromo-N'-[2-(3-nitroanilino)acetyl]benzohydrazide (PubChem CID 9081549) has the molecular formula C15H13BrN4O4 and a molecular weight of 393.20 g/mol. Its IUPAC name is 2-bromo-N'-[2-(3-nitroanilino)acetyl]benzohydrazide.
| Compound Name | 2-bromo-N'-[2-(3-nitroanilino)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9081549 |
| Molecular Formula | C15H13BrN4O4 |
| Molecular Weight | 393.20 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 2-bromo-N'-[2-(3-nitroanilino)acetyl]benzohydrazide |
| SMILES | O=C(CNc1cccc([N+](=O)[O-])c1)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C15H13BrN4O4/c16-13-7-2-1-6-12(13)15(22)19-18-14(21)9-17-10-4-3-5-11(8-10)20(23)24/h1-8,17H,9H2,(H,18,21)(H,19,22) |
| InChIKey | KQQVVEIFGUBFDL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|