C18H20ClN5O7 — CID 87642861
2-chloro-N-(3-nitrophenyl)acetamide;N-(2-hydroxyethyl)-2-(3-nitroanilino)acetamide (PubChem CID 87642861) has the molecular formula C18H20ClN5O7 and a molecular weight of 453.84 g/mol. Its IUPAC name is 2-chloro-N-(3-nitrophenyl)acetamide;N-(2-hydroxyethyl)-2-(3-nitroanilino)acetamide.
| Compound Name | 2-chloro-N-(3-nitrophenyl)acetamide;N-(2-hydroxyethyl)-2-(3-nitroanilino)acetamide |
|---|---|
| PubChem CID | 87642861 |
| Molecular Formula | C18H20ClN5O7 |
| Molecular Weight | 453.84 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-chloro-N-(3-nitrophenyl)acetamide;N-(2-hydroxyethyl)-2-(3-nitroanilino)acetamide |
| SMILES | O=C(CCl)Nc1cccc([N+](=O)[O-])c1.O=C(CNc1cccc([N+](=O)[O-])c1)NCCO |
| InChI | InChI=1S/C10H13N3O4.C8H7ClN2O3/c14-5-4-11-10(15)7-12-8-2-1-3-9(6-8)13(16)17;9-5-8(12)10-6-2-1-3-7(4-6)11(13)14/h1-3,6,12,14H,4-5,7H2,(H,11,15);1-4H,5H2,(H,10,12) |
| InChIKey | NPFBRZINLPLQTA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 176.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.84 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|