C30H50N6O6 — CID 129082384
N-butyl-6-[6-[6-[[2-(3-nitroanilino)acetyl]amino]hexanoylamino]hexanoylamino]hexanamide (PubChem CID 129082384) has the molecular formula C30H50N6O6 and a molecular weight of 590.77 g/mol. Its IUPAC name is N-butyl-6-[6-[6-[[2-(3-nitroanilino)acetyl]amino]hexanoylamino]hexanoylamino]hexanamide.
| Compound Name | N-butyl-6-[6-[6-[[2-(3-nitroanilino)acetyl]amino]hexanoylamino]hexanoylamino]hexanamide |
|---|---|
| PubChem CID | 129082384 |
| Molecular Formula | C30H50N6O6 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | N-butyl-6-[6-[6-[[2-(3-nitroanilino)acetyl]amino]hexanoylamino]hexanoylamino]hexanamide |
| SMILES | CCCCNC(=O)CCCCCNC(=O)CCCCCNC(=O)CCCCCNC(=O)CNc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H50N6O6/c1-2-3-19-31-27(37)16-7-4-10-20-32-28(38)17-8-5-11-21-33-29(39)18-9-6-12-22-34-30(40)24-35-25-14-13-15-26(23-25)36(41)42/h13-15,23,35H,2-12,16-22,24H2,1H3,(H,31,37)(H,32,38)(H,33,39)(H,34,40) |
| InChIKey | SVOJYWVBOTUZEB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 171.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|