C28H43N5O8S2 — CID 159247575
(2,5-dioxopyrrolidin-1-yl) 6-[[9-(3-nitroanilino)-8-oxononanoyl]amino]hexanoate;N-(3-tritiosulfanylpropyl)thiohydroxylamine (PubChem CID 159247575) has the molecular formula C28H43N5O8S2 and a molecular weight of 643.82 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[9-(3-nitroanilino)-8-oxononanoyl]amino]hexanoate;N-(3-tritiosulfanylpropyl)thiohydroxylamine.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[9-(3-nitroanilino)-8-oxononanoyl]amino]hexanoate;N-(3-tritiosulfanylpropyl)thiohydroxylamine |
|---|---|
| PubChem CID | 159247575 |
| Molecular Formula | C28H43N5O8S2 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[9-(3-nitroanilino)-8-oxononanoyl]amino]hexanoate;N-(3-tritiosulfanylpropyl)thiohydroxylamine |
| SMILES | O=C(CCCCCCC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O)CNc1cccc([N+](=O)[O-])c1.[3H]SCCCNS |
| InChI | InChI=1S/C25H34N4O8.C3H9NS2/c30-21(18-27-19-9-8-10-20(17-19)29(35)36)11-4-1-2-5-12-22(31)26-16-7-3-6-13-25(34)37-28-23(32)14-15-24(28)33;5-3-1-2-4-6/h8-10,17,27H,1-7,11-16,18H2,(H,26,31);4-6H,1-3H2/i/hT |
| InChIKey | KUWJLELPDGHRFG-MNYXATJNSA-N |
| XLogP | 3.94 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|