C11H12N2O3 — CID 137099066
1-diazo-3-(3,4-dimethoxyphenyl)propan-2-one (PubChem CID 137099066) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-diazo-3-(3,4-dimethoxyphenyl)propan-2-one.
| Compound Name | 1-diazo-3-(3,4-dimethoxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 137099066 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-diazo-3-(3,4-dimethoxyphenyl)propan-2-one |
| SMILES | COc1ccc(CC(=O)C=[N+]=[N-])cc1OC |
| InChI | InChI=1S/C11H12N2O3/c1-15-10-4-3-8(6-11(10)16-2)5-9(14)7-13-12/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | SNMPZTGPYDZZDB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|