C12H7F2IOS — CID 114964088
2-(2,5-difluorophenyl)-1-(5-iodothiophen-3-yl)ethanone (PubChem CID 114964088) has the molecular formula C12H7F2IOS and a molecular weight of 364.15 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-(5-iodothiophen-3-yl)ethanone.
| Compound Name | 2-(2,5-difluorophenyl)-1-(5-iodothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 114964088 |
| Molecular Formula | C12H7F2IOS |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-(5-iodothiophen-3-yl)ethanone |
| SMILES | O=C(Cc1cc(F)ccc1F)c1csc(I)c1 |
| InChI | InChI=1S/C12H7F2IOS/c13-9-1-2-10(14)7(3-9)4-11(16)8-5-12(15)17-6-8/h1-3,5-6H,4H2 |
| InChIKey | JNFCODZOMRSQAI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|