C15H10Br2F2O2 — CID 107538191
1-(2-bromo-3,4-difluorophenyl)-2-(3-bromo-4-methoxyphenyl)ethanone (PubChem CID 107538191) has the molecular formula C15H10Br2F2O2 and a molecular weight of 420.05 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(3-bromo-4-methoxyphenyl)ethanone.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(3-bromo-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 107538191 |
| Molecular Formula | C15H10Br2F2O2 |
| Molecular Weight | 420.05 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(3-bromo-4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)c2ccc(F)c(F)c2Br)cc1Br |
| InChI | InChI=1S/C15H10Br2F2O2/c1-21-13-5-2-8(6-10(13)16)7-12(20)9-3-4-11(18)15(19)14(9)17/h2-6H,7H2,1H3 |
| InChIKey | UYCQJYKINXCPMM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.05 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|