C15H13BrO4 — CID 58913124
1-(5-bromo-2-hydroxy-4-methoxyphenyl)-2-(4-hydroxyphenyl)ethanone (PubChem CID 58913124) has the molecular formula C15H13BrO4 and a molecular weight of 337.17 g/mol. Its IUPAC name is 1-(5-bromo-2-hydroxy-4-methoxyphenyl)-2-(4-hydroxyphenyl)ethanone.
| Compound Name | 1-(5-bromo-2-hydroxy-4-methoxyphenyl)-2-(4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 58913124 |
| Molecular Formula | C15H13BrO4 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 1-(5-bromo-2-hydroxy-4-methoxyphenyl)-2-(4-hydroxyphenyl)ethanone |
| SMILES | COc1cc(O)c(C(=O)Cc2ccc(O)cc2)cc1Br |
| InChI | InChI=1S/C15H13BrO4/c1-20-15-8-14(19)11(7-12(15)16)13(18)6-9-2-4-10(17)5-3-9/h2-5,7-8,17,19H,6H2,1H3 |
| InChIKey | YTWQMVVZKBIHKX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |