C12H14BrClO2 — CID 82124813
2-bromo-3-chloro-1-(2-methoxy-4,5-dimethylphenyl)propan-1-one (PubChem CID 82124813) has the molecular formula C12H14BrClO2 and a molecular weight of 305.60 g/mol. Its IUPAC name is 2-bromo-3-chloro-1-(2-methoxy-4,5-dimethylphenyl)propan-1-one.
| Compound Name | 2-bromo-3-chloro-1-(2-methoxy-4,5-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 82124813 |
| Molecular Formula | C12H14BrClO2 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 2-bromo-3-chloro-1-(2-methoxy-4,5-dimethylphenyl)propan-1-one |
| SMILES | COc1cc(C)c(C)cc1C(=O)C(Br)CCl |
| InChI | InChI=1S/C12H14BrClO2/c1-7-4-9(12(15)10(13)6-14)11(16-3)5-8(7)2/h4-5,10H,6H2,1-3H3 |
| InChIKey | UCACVXMWFNTSLS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|