C11H11NO2 — CID 116918953
2-methoxy-4,5-dimethylbenzoyl cyanide (PubChem CID 116918953) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethylbenzoyl cyanide.
| Compound Name | 2-methoxy-4,5-dimethylbenzoyl cyanide |
|---|---|
| PubChem CID | 116918953 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-methoxy-4,5-dimethylbenzoyl cyanide |
| SMILES | COc1cc(C)c(C)cc1C(=O)C#N |
| InChI | InChI=1S/C11H11NO2/c1-7-4-9(10(13)6-12)11(14-3)5-8(7)2/h4-5H,1-3H3 |
| InChIKey | OLXSWBGMHPKGSW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|