2,5-dimethoxy-4-methylbenzoyl cyanide

C11H11NO3 — CID 116918983

IUPAC2,5-dimethoxy-4-methylbenzoyl cyanide
SMILESCOc1cc(C(=O)C#N)c(OC)cc1C
InChIInChI=1S/C11H11NO3/c1-7-4-11(15-3)8(9(13)6-12)5-10(7)14-2/h4-5H,1-3H3
InChIKeyBRLVNVLFRQPJEM-UHFFFAOYSA-N
MW205.21 g/mol
LogP1.72
Rot. Bonds3

About 2,5-dimethoxy-4-methylbenzoyl cyanide

2,5-dimethoxy-4-methylbenzoyl cyanide (PubChem CID 116918983) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2,5-dimethoxy-4-methylbenzoyl cyanide.

Molecular Properties

Compound Name2,5-dimethoxy-4-methylbenzoyl cyanide
PubChem CID116918983
Molecular FormulaC11H11NO3
Molecular Weight205.21 g/mol
Exact Mass205.07
IUPAC Name2,5-dimethoxy-4-methylbenzoyl cyanide
SMILESCOc1cc(C(=O)C#N)c(OC)cc1C
InChIInChI=1S/C11H11NO3/c1-7-4-11(15-3)8(9(13)6-12)5-10(7)14-2/h4-5H,1-3H3
InChIKeyBRLVNVLFRQPJEM-UHFFFAOYSA-N
XLogP1.72
TPSA59.32 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.21
LogP ≤ 51.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}

Analyze 2,5-dimethoxy-4-methylbenzoyl cyanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dimethoxy-4-methylbenzoyl cyanide?
The IUPAC name of 2,5-dimethoxy-4-methylbenzoyl cyanide (CID 116918983) is 2,5-dimethoxy-4-methylbenzoyl cyanide.
What is the SMILES notation for 2,5-dimethoxy-4-methylbenzoyl cyanide?
The canonical SMILES for 2,5-dimethoxy-4-methylbenzoyl cyanide is COc1cc(C(=O)C#N)c(OC)cc1C.
What is the InChIKey of 2,5-dimethoxy-4-methylbenzoyl cyanide?
The InChIKey is BRLVNVLFRQPJEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-7-4-11(15-3)8(9(13)6-12)5-10(7)14-2/h4-5H,1-3H3.
What are the key properties of 2,5-dimethoxy-4-methylbenzoyl cyanide?
2,5-dimethoxy-4-methylbenzoyl cyanide has a molecular weight of 205.21 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxy-4-methylbenzoyl cyanide is sourced from PubChem (CID 116918983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).