C11H11NO3 — CID 116918983
2,5-dimethoxy-4-methylbenzoyl cyanide (PubChem CID 116918983) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2,5-dimethoxy-4-methylbenzoyl cyanide.
| Compound Name | 2,5-dimethoxy-4-methylbenzoyl cyanide |
|---|---|
| PubChem CID | 116918983 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2,5-dimethoxy-4-methylbenzoyl cyanide |
| SMILES | COc1cc(C(=O)C#N)c(OC)cc1C |
| InChI | InChI=1S/C11H11NO3/c1-7-4-11(15-3)8(9(13)6-12)5-10(7)14-2/h4-5H,1-3H3 |
| InChIKey | BRLVNVLFRQPJEM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|