About fluoroform;4-hydroxybenzaldehyde
fluoroform;4-hydroxybenzaldehyde (PubChem CID 158009924) has the molecular formula C8H7F3O2
and a molecular weight of 192.14 g/mol. Its IUPAC name is fluoroform;4-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | fluoroform;4-hydroxybenzaldehyde |
| PubChem CID | 158009924 |
| Molecular Formula | C8H7F3O2 |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | fluoroform;4-hydroxybenzaldehyde |
| SMILES | FC(F)F.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O2.CHF3/c8-5-6-1-3-7(9)4-2-6;2-1(3)4/h1-5,9H;1H |
| InChIKey | FETHUHLPTYKYRB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze fluoroform;4-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;4-hydroxybenzaldehyde?
The IUPAC name of fluoroform;4-hydroxybenzaldehyde (CID 158009924) is fluoroform;4-hydroxybenzaldehyde.
What is the SMILES notation for fluoroform;4-hydroxybenzaldehyde?
The canonical SMILES for fluoroform;4-hydroxybenzaldehyde is FC(F)F.O=Cc1ccc(O)cc1.
What is the InChIKey of fluoroform;4-hydroxybenzaldehyde?
The InChIKey is FETHUHLPTYKYRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.CHF3/c8-5-6-1-3-7(9)4-2-6;2-1(3)4/h1-5,9H;1H.
What are the key properties of fluoroform;4-hydroxybenzaldehyde?
fluoroform;4-hydroxybenzaldehyde has a molecular weight of 192.14 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;4-hydroxybenzaldehyde is sourced from PubChem (CID 158009924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).