C35H46O5 — CID 175013627
2,3-bis(2-hydroxy-4-octoxyphenyl)benzaldehyde (PubChem CID 175013627) has the molecular formula C35H46O5 and a molecular weight of 546.75 g/mol. Its IUPAC name is 2,3-bis(2-hydroxy-4-octoxyphenyl)benzaldehyde.
| Compound Name | 2,3-bis(2-hydroxy-4-octoxyphenyl)benzaldehyde |
|---|---|
| PubChem CID | 175013627 |
| Molecular Formula | C35H46O5 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 2,3-bis(2-hydroxy-4-octoxyphenyl)benzaldehyde |
| SMILES | CCCCCCCCOc1ccc(-c2cccc(C=O)c2-c2ccc(OCCCCCCCC)cc2O)c(O)c1 |
| InChI | InChI=1S/C35H46O5/c1-3-5-7-9-11-13-22-39-28-18-20-30(33(37)24-28)31-17-15-16-27(26-36)35(31)32-21-19-29(25-34(32)38)40-23-14-12-10-8-6-4-2/h15-21,24-26,37-38H,3-14,22-23H2,1-2H3 |
| InChIKey | ZHJQLSGPFIBVQZ-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|