C16H10N2O3 — CID 902671
methyl 4-(2,3-dicyanophenoxy)benzoate (PubChem CID 902671) has the molecular formula C16H10N2O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is methyl 4-(2,3-dicyanophenoxy)benzoate.
| Compound Name | methyl 4-(2,3-dicyanophenoxy)benzoate |
|---|---|
| PubChem CID | 902671 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | methyl 4-(2,3-dicyanophenoxy)benzoate |
| SMILES | COC(=O)c1ccc(Oc2cccc(C#N)c2C#N)cc1 |
| InChI | InChI=1S/C16H10N2O3/c1-20-16(19)11-5-7-13(8-6-11)21-15-4-2-3-12(9-17)14(15)10-18/h2-8H,1H3 |
| InChIKey | TWTJGQZPLDGIGK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |