C34H24N2O4 — CID 170296414
2-[4-[4-[2-cyano-3-(4-methoxyphenoxy)phenoxy]phenyl]phenoxy]-6-methylbenzonitrile (PubChem CID 170296414) has the molecular formula C34H24N2O4 and a molecular weight of 524.58 g/mol. Its IUPAC name is 2-[4-[4-[2-cyano-3-(4-methoxyphenoxy)phenoxy]phenyl]phenoxy]-6-methylbenzonitrile.
| Compound Name | 2-[4-[4-[2-cyano-3-(4-methoxyphenoxy)phenoxy]phenyl]phenoxy]-6-methylbenzonitrile |
|---|---|
| PubChem CID | 170296414 |
| Molecular Formula | C34H24N2O4 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 2-[4-[4-[2-cyano-3-(4-methoxyphenoxy)phenoxy]phenyl]phenoxy]-6-methylbenzonitrile |
| SMILES | COc1ccc(Oc2cccc(Oc3ccc(-c4ccc(Oc5cccc(C)c5C#N)cc4)cc3)c2C#N)cc1 |
| InChI | InChI=1S/C34H24N2O4/c1-23-5-3-6-32(30(23)21-35)38-27-13-9-24(10-14-27)25-11-15-28(16-12-25)39-33-7-4-8-34(31(33)22-36)40-29-19-17-26(37-2)18-20-29/h3-20H,1-2H3 |
| InChIKey | PSWJHIDLBSHREM-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |