C21H46O8Si3 — CID 167565541
3-[[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-[3-(2-hydroxyethoxy)propyl-methylsilyl]oxy-methylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 167565541) has the molecular formula C21H46O8Si3 and a molecular weight of 510.85 g/mol. Its IUPAC name is 3-[[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-[3-(2-hydroxyethoxy)propyl-methylsilyl]oxy-methylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-[3-(2-hydroxyethoxy)propyl-methylsilyl]oxy-methylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167565541 |
| Molecular Formula | C21H46O8Si3 |
| Molecular Weight | 510.85 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 3-[[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-[3-(2-hydroxyethoxy)propyl-methylsilyl]oxy-methylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(O[SiH](C)CCCOCCO)O[Si](C)(C)CCCOCCO |
| InChI | InChI=1S/C21H46O8Si3/c1-20(2)21(24)27-14-9-19-32(6,28-30(3)17-7-12-25-15-10-22)29-31(4,5)18-8-13-26-16-11-23/h22-23,30H,1,7-19H2,2-6H3 |
| InChIKey | DCMIZDOHSSFDNK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|