C9H16O5 — CID 173264602
methyl 2-[2-(2-hydroxyethoxy)ethoxy]but-2-enoate (PubChem CID 173264602) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is methyl 2-[2-(2-hydroxyethoxy)ethoxy]but-2-enoate.
| Compound Name | methyl 2-[2-(2-hydroxyethoxy)ethoxy]but-2-enoate |
|---|---|
| PubChem CID | 173264602 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | methyl 2-[2-(2-hydroxyethoxy)ethoxy]but-2-enoate |
| SMILES | CC=C(OCCOCCO)C(=O)OC |
| InChI | InChI=1S/C9H16O5/c1-3-8(9(11)12-2)14-7-6-13-5-4-10/h3,10H,4-7H2,1-2H3 |
| InChIKey | QYMXQXBZCJNYSM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|