C13H22O8 — CID 118048851
dimethyl (E)-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]but-2-enedioate (PubChem CID 118048851) has the molecular formula C13H22O8 and a molecular weight of 306.31 g/mol. Its IUPAC name is dimethyl (E)-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]but-2-enedioate |
|---|---|
| PubChem CID | 118048851 |
| Molecular Formula | C13H22O8 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | dimethyl (E)-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]but-2-enedioate |
| SMILES | COCCOCCOCCO/C(=C/C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H22O8/c1-16-4-5-19-6-7-20-8-9-21-11(13(15)18-3)10-12(14)17-2/h10H,4-9H2,1-3H3/b11-10+ |
| InChIKey | KALGJFFEKYCTQB-ZHACJKMWSA-N |
| XLogP | -0.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|