C11H18O7 — CID 118048854
dimethyl (E)-2-[2-(2-methoxyethoxy)ethoxy]but-2-enedioate (PubChem CID 118048854) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(2-methoxyethoxy)ethoxy]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(2-methoxyethoxy)ethoxy]but-2-enedioate |
|---|---|
| PubChem CID | 118048854 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | dimethyl (E)-2-[2-(2-methoxyethoxy)ethoxy]but-2-enedioate |
| SMILES | COCCOCCO/C(=C/C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H18O7/c1-14-4-5-17-6-7-18-9(11(13)16-3)8-10(12)15-2/h8H,4-7H2,1-3H3/b9-8+ |
| InChIKey | BRLDDQSOKOEVSY-CMDGGOBGSA-N |
| XLogP | -0.10 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|