C26H38O8 — CID 175186210
tributyl 2-(2-phenylacetyl)oxypropane-1,2,3-tricarboxylate (PubChem CID 175186210) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is tributyl 2-(2-phenylacetyl)oxypropane-1,2,3-tricarboxylate.
| Compound Name | tributyl 2-(2-phenylacetyl)oxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 175186210 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | tributyl 2-(2-phenylacetyl)oxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCOC(=O)CC(CC(=O)OCCCC)(OC(=O)Cc1ccccc1)C(=O)OCCCC |
| InChI | InChI=1S/C26H38O8/c1-4-7-15-31-23(28)19-26(25(30)33-17-9-6-3,20-24(29)32-16-8-5-2)34-22(27)18-21-13-11-10-12-14-21/h10-14H,4-9,15-20H2,1-3H3 |
| InChIKey | FTSSDJABXXHJON-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|