C20H26O8 — CID 175186027
triethyl 2-(2-phenylacetyl)oxypropane-1,2,3-tricarboxylate (PubChem CID 175186027) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is triethyl 2-(2-phenylacetyl)oxypropane-1,2,3-tricarboxylate.
| Compound Name | triethyl 2-(2-phenylacetyl)oxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 175186027 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | triethyl 2-(2-phenylacetyl)oxypropane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(OC(=O)Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C20H26O8/c1-4-25-17(22)13-20(19(24)27-6-3,14-18(23)26-5-2)28-16(21)12-15-10-8-7-9-11-15/h7-11H,4-6,12-14H2,1-3H3 |
| InChIKey | HECNCTVIYCHIQD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|