C20H24O10 — CID 174510548
2-(1,5-diethoxy-3-ethoxycarbonyl-1,5-dioxopentan-3-yl)oxycarbonylbenzoic acid (PubChem CID 174510548) has the molecular formula C20H24O10 and a molecular weight of 424.40 g/mol. Its IUPAC name is 2-(1,5-diethoxy-3-ethoxycarbonyl-1,5-dioxopentan-3-yl)oxycarbonylbenzoic acid.
| Compound Name | 2-(1,5-diethoxy-3-ethoxycarbonyl-1,5-dioxopentan-3-yl)oxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 174510548 |
| Molecular Formula | C20H24O10 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-(1,5-diethoxy-3-ethoxycarbonyl-1,5-dioxopentan-3-yl)oxycarbonylbenzoic acid |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(OC(=O)c1ccccc1C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C20H24O10/c1-4-27-15(21)11-20(19(26)29-6-3,12-16(22)28-5-2)30-18(25)14-10-8-7-9-13(14)17(23)24/h7-10H,4-6,11-12H2,1-3H3,(H,23,24) |
| InChIKey | UMULLXFQPMPXNI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|