C17H27O5P — CID 122589227
[3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] diethyl phosphate (PubChem CID 122589227) has the molecular formula C17H27O5P and a molecular weight of 342.37 g/mol. Its IUPAC name is [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] diethyl phosphate.
| Compound Name | [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] diethyl phosphate |
|---|---|
| PubChem CID | 122589227 |
| Molecular Formula | C17H27O5P |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)Oc1cc(C)cc(C)c1C(C)(C)CC=O |
| InChI | InChI=1S/C17H27O5P/c1-7-20-23(19,21-8-2)22-15-12-13(3)11-14(4)16(15)17(5,6)9-10-18/h10-12H,7-9H2,1-6H3 |
| InChIKey | RWEVFZRLTPRBSS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|