C23H38O3 — CID 155685112
[2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenyl] decanoate (PubChem CID 155685112) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is [2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenyl] decanoate.
| Compound Name | [2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenyl] decanoate |
|---|---|
| PubChem CID | 155685112 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | [2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenyl] decanoate |
| SMILES | CCCCCCCCCC(=O)Oc1cc(C)cc(C)c1C(C)(C)CCO |
| InChI | InChI=1S/C23H38O3/c1-6-7-8-9-10-11-12-13-21(25)26-20-17-18(2)16-19(3)22(20)23(4,5)14-15-24/h16-17,24H,6-15H2,1-5H3 |
| InChIKey | MMYGPSCDOJLKHK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|