C26H36O3 — CID 122589315
[2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenyl] 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 122589315) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is [2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenyl] 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | [2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenyl] 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 122589315 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | [2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenyl] 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | Cc1cc(C)c(C(C)(C)CCO)c(OC(=O)C(C)c2ccc(CC(C)C)cc2)c1 |
| InChI | InChI=1S/C26H36O3/c1-17(2)14-21-8-10-22(11-9-21)20(5)25(28)29-23-16-18(3)15-19(4)24(23)26(6,7)12-13-27/h8-11,15-17,20,27H,12-14H2,1-7H3 |
| InChIKey | RIZGRAVCHUBTJO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|