C21H26O2 — CID 4073405
(2,4-dimethylphenyl) 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 4073405) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | (2,4-dimethylphenyl) 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 4073405 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (2,4-dimethylphenyl) 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | Cc1ccc(OC(=O)C(C)c2ccc(CC(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C21H26O2/c1-14(2)12-18-7-9-19(10-8-18)17(5)21(22)23-20-11-6-15(3)13-16(20)4/h6-11,13-14,17H,12H2,1-5H3 |
| InChIKey | FYWFHACEWUBVLH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|