C18H20O3 — CID 105344783
2-[4-[(2,4-dimethylphenoxy)methyl]phenyl]propanoic acid (PubChem CID 105344783) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[4-[(2,4-dimethylphenoxy)methyl]phenyl]propanoic acid.
| Compound Name | 2-[4-[(2,4-dimethylphenoxy)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 105344783 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[4-[(2,4-dimethylphenoxy)methyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(OCc2ccc(C(C)C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C18H20O3/c1-12-4-9-17(13(2)10-12)21-11-15-5-7-16(8-6-15)14(3)18(19)20/h4-10,14H,11H2,1-3H3,(H,19,20) |
| InChIKey | XTFAJKHISXNTAV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |