C28H30N2O6 — CID 57077994
ethyl (2S)-3-[4-(benzylcarbamoyl)phenyl]-2-[(2,6-dimethoxybenzoyl)amino]propanoate (PubChem CID 57077994) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is ethyl (2S)-3-[4-(benzylcarbamoyl)phenyl]-2-[(2,6-dimethoxybenzoyl)amino]propanoate.
| Compound Name | ethyl (2S)-3-[4-(benzylcarbamoyl)phenyl]-2-[(2,6-dimethoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 57077994 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | ethyl (2S)-3-[4-(benzylcarbamoyl)phenyl]-2-[(2,6-dimethoxybenzoyl)amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(C(=O)NCc2ccccc2)cc1)NC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C28H30N2O6/c1-4-36-28(33)22(30-27(32)25-23(34-2)11-8-12-24(25)35-3)17-19-13-15-21(16-14-19)26(31)29-18-20-9-6-5-7-10-20/h5-16,22H,4,17-18H2,1-3H3,(H,29,31)(H,30,32)/t22-/m0/s1 |
| InChIKey | MBBLAXMZQMESPL-QFIPXVFZSA-N |
| XLogP | 3.54 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |