C15H20N2O3 — CID 79548414
N-(2,2-diethoxyethyl)-1H-indole-4-carboxamide (PubChem CID 79548414) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-1H-indole-4-carboxamide.
| Compound Name | N-(2,2-diethoxyethyl)-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 79548414 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-(2,2-diethoxyethyl)-1H-indole-4-carboxamide |
| SMILES | CCOC(CNC(=O)c1cccc2[nH]ccc12)OCC |
| InChI | InChI=1S/C15H20N2O3/c1-3-19-14(20-4-2)10-17-15(18)12-6-5-7-13-11(12)8-9-16-13/h5-9,14,16H,3-4,10H2,1-2H3,(H,17,18) |
| InChIKey | WTAXKMPJVCFZGS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|