C15H19N3O2 — CID 115672235
N-[2-(2-methylpropylamino)-2-oxoethyl]-1H-indole-4-carboxamide (PubChem CID 115672235) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-[2-(2-methylpropylamino)-2-oxoethyl]-1H-indole-4-carboxamide.
| Compound Name | N-[2-(2-methylpropylamino)-2-oxoethyl]-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 115672235 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[2-(2-methylpropylamino)-2-oxoethyl]-1H-indole-4-carboxamide |
| SMILES | CC(C)CNC(=O)CNC(=O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C15H19N3O2/c1-10(2)8-17-14(19)9-18-15(20)12-4-3-5-13-11(12)6-7-16-13/h3-7,10,16H,8-9H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | AUGVBFJMCOERFS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |