C13H14N2O4 — CID 103957814
methyl 2-hydroxy-3-(1H-indole-4-carbonylamino)propanoate (PubChem CID 103957814) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is methyl 2-hydroxy-3-(1H-indole-4-carbonylamino)propanoate.
| Compound Name | methyl 2-hydroxy-3-(1H-indole-4-carbonylamino)propanoate |
|---|---|
| PubChem CID | 103957814 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 2-hydroxy-3-(1H-indole-4-carbonylamino)propanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C13H14N2O4/c1-19-13(18)11(16)7-15-12(17)9-3-2-4-10-8(9)5-6-14-10/h2-6,11,14,16H,7H2,1H3,(H,15,17) |
| InChIKey | RFFXGDPTHKOOSP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |