C12H21N3O3 — CID 79547804
N-(2,2-diethoxyethyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 79547804) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2,2-diethoxyethyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 79547804 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-(2,2-diethoxyethyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | CCOC(CNC(=O)c1c(C)n[nH]c1C)OCC |
| InChI | InChI=1S/C12H21N3O3/c1-5-17-10(18-6-2)7-13-12(16)11-8(3)14-15-9(11)4/h10H,5-7H2,1-4H3,(H,13,16)(H,14,15) |
| InChIKey | FZVFEQQBQTWHTJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|