C7H10N2O2 — CID 2753080
methyl 3,5-dimethyl-1H-pyrazole-4-carboxylate (PubChem CID 2753080) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is methyl 3,5-dimethyl-1H-pyrazole-4-carboxylate.
| Compound Name | methyl 3,5-dimethyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2753080 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | methyl 3,5-dimethyl-1H-pyrazole-4-carboxylate |
| SMILES | COC(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C7H10N2O2/c1-4-6(7(10)11-3)5(2)9-8-4/h1-3H3,(H,8,9) |
| InChIKey | HYULAOVKUFWMCB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |