C7H11N3O — CID 82416902
2-amino-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethanone (PubChem CID 82416902) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-amino-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethanone.
| Compound Name | 2-amino-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 82416902 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 2-amino-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethanone |
| SMILES | Cc1n[nH]c(C)c1C(=O)CN |
| InChI | InChI=1S/C7H11N3O/c1-4-7(6(11)3-8)5(2)10-9-4/h3,8H2,1-2H3,(H,9,10) |
| InChIKey | RYSZTYMWXUSWDZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |