C10H12Br2ClNOS — CID 114303626
4,5-dibromo-N-(1-chloro-2-methylbutan-2-yl)thiophene-2-carboxamide (PubChem CID 114303626) has the molecular formula C10H12Br2ClNOS and a molecular weight of 389.54 g/mol. Its IUPAC name is 4,5-dibromo-N-(1-chloro-2-methylbutan-2-yl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(1-chloro-2-methylbutan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114303626 |
| Molecular Formula | C10H12Br2ClNOS |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 386.87 |
| IUPAC Name | 4,5-dibromo-N-(1-chloro-2-methylbutan-2-yl)thiophene-2-carboxamide |
| SMILES | CCC(C)(CCl)NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H12Br2ClNOS/c1-3-10(2,5-13)14-9(15)7-4-6(11)8(12)16-7/h4H,3,5H2,1-2H3,(H,14,15) |
| InChIKey | NTDLNPFSBRJZSM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|