C13H16BrNOS2 — CID 114153197
N-(1-bromo-3-methylpentan-3-yl)thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 114153197) has the molecular formula C13H16BrNOS2 and a molecular weight of 346.32 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 114153197 |
| Molecular Formula | C13H16BrNOS2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | CCC(C)(CCBr)NC(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C13H16BrNOS2/c1-3-13(2,5-6-14)15-12(16)11-8-10-9(18-11)4-7-17-10/h4,7-8H,3,5-6H2,1-2H3,(H,15,16) |
| InChIKey | IVVCUYMQKFSYTA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|