C11H14Br2N2O3S — CID 103882820
2,4-dibromo-N-[2-(ethylsulfamoyl)ethyl]benzamide (PubChem CID 103882820) has the molecular formula C11H14Br2N2O3S and a molecular weight of 414.12 g/mol. Its IUPAC name is 2,4-dibromo-N-[2-(ethylsulfamoyl)ethyl]benzamide.
| Compound Name | 2,4-dibromo-N-[2-(ethylsulfamoyl)ethyl]benzamide |
|---|---|
| PubChem CID | 103882820 |
| Molecular Formula | C11H14Br2N2O3S |
| Molecular Weight | 414.12 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | 2,4-dibromo-N-[2-(ethylsulfamoyl)ethyl]benzamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H14Br2N2O3S/c1-2-15-19(17,18)6-5-14-11(16)9-4-3-8(12)7-10(9)13/h3-4,7,15H,2,5-6H2,1H3,(H,14,16) |
| InChIKey | BGOKCINWGMAEMY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.12 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |