C12H20N4O3S — CID 106340923
N-[2-(ethylsulfamoyl)ethyl]-4-hydrazinyl-2-methylbenzamide (PubChem CID 106340923) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[2-(ethylsulfamoyl)ethyl]-4-hydrazinyl-2-methylbenzamide.
| Compound Name | N-[2-(ethylsulfamoyl)ethyl]-4-hydrazinyl-2-methylbenzamide |
|---|---|
| PubChem CID | 106340923 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[2-(ethylsulfamoyl)ethyl]-4-hydrazinyl-2-methylbenzamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)c1ccc(NN)cc1C |
| InChI | InChI=1S/C12H20N4O3S/c1-3-15-20(18,19)7-6-14-12(17)11-5-4-10(16-13)8-9(11)2/h4-5,8,15-16H,3,6-7,13H2,1-2H3,(H,14,17) |
| InChIKey | WKKMGBYCUZOPPY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|