C14H18N4O — CID 102705968
5-amino-N-[2-(1H-imidazol-2-yl)ethyl]-2,4-dimethylbenzamide (PubChem CID 102705968) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-amino-N-[2-(1H-imidazol-2-yl)ethyl]-2,4-dimethylbenzamide.
| Compound Name | 5-amino-N-[2-(1H-imidazol-2-yl)ethyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 102705968 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 5-amino-N-[2-(1H-imidazol-2-yl)ethyl]-2,4-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NCCc2ncc[nH]2)cc1N |
| InChI | InChI=1S/C14H18N4O/c1-9-7-10(2)12(15)8-11(9)14(19)18-4-3-13-16-5-6-17-13/h5-8H,3-4,15H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | IBOIUCANBXDKEV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|