C11H13N3OS — CID 115679033
N-[2-(1H-imidazol-2-yl)ethyl]-4-methylthiophene-3-carboxamide (PubChem CID 115679033) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is N-[2-(1H-imidazol-2-yl)ethyl]-4-methylthiophene-3-carboxamide.
| Compound Name | N-[2-(1H-imidazol-2-yl)ethyl]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 115679033 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-[2-(1H-imidazol-2-yl)ethyl]-4-methylthiophene-3-carboxamide |
| SMILES | Cc1cscc1C(=O)NCCc1ncc[nH]1 |
| InChI | InChI=1S/C11H13N3OS/c1-8-6-16-7-9(8)11(15)14-3-2-10-12-4-5-13-10/h4-7H,2-3H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | GWNWNCHNEITMBS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |