2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride

C11H13ClO3 — CID 91113458

IUPAC2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride
SMILESCOc1cc(C)c(CC(=O)Cl)cc1OC
InChIInChI=1S/C11H13ClO3/c1-7-4-9(14-2)10(15-3)5-8(7)6-11(12)13/h4-5H,6H2,1-3H3
InChIKeyFATBDOXFYYWIMI-UHFFFAOYSA-N
MW228.67 g/mol
LogP2.32
Rot. Bonds4

About 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride

2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride (PubChem CID 91113458) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride.

Molecular Properties

Compound Name2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride
PubChem CID91113458
Molecular FormulaC11H13ClO3
Molecular Weight228.67 g/mol
Exact Mass228.06
IUPAC Name2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride
SMILESCOc1cc(C)c(CC(=O)Cl)cc1OC
InChIInChI=1S/C11H13ClO3/c1-7-4-9(14-2)10(15-3)5-8(7)6-11(12)13/h4-5H,6H2,1-3H3
InChIKeyFATBDOXFYYWIMI-UHFFFAOYSA-N
XLogP2.32
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.67
LogP ≤ 52.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride?
The IUPAC name of 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride (CID 91113458) is 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride.
What is the SMILES notation for 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride?
The canonical SMILES for 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride is COc1cc(C)c(CC(=O)Cl)cc1OC.
What is the InChIKey of 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride?
The InChIKey is FATBDOXFYYWIMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO3/c1-7-4-9(14-2)10(15-3)5-8(7)6-11(12)13/h4-5H,6H2,1-3H3.
What are the key properties of 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride?
2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride has a molecular weight of 228.67 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethoxy-2-methylphenyl)acetyl chloride is sourced from PubChem (CID 91113458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).